C19H28FN3O3 — CID 126444711
(3S)-3-[[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid (PubChem CID 126444711) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is (3S)-3-[[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid.
| Compound Name | (3S)-3-[[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 126444711 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (3S)-3-[[4-[(3-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid |
| SMILES | CCCC[C@@H](CC(=O)O)NC(=O)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H28FN3O3/c1-2-3-7-17(13-18(24)25)21-19(26)23-10-8-22(9-11-23)14-15-5-4-6-16(20)12-15/h4-6,12,17H,2-3,7-11,13-14H2,1H3,(H,21,26)(H,24,25)/t17-/m0/s1 |
| InChIKey | GZAWSJNWDLDUKK-KRWDZBQOSA-N |
| XLogP | 2.69 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |