About (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane
(1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 12644663) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane.
Analyze (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
The IUPAC name of (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane (CID 12644663) is (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane.
What is the SMILES notation for (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
The canonical SMILES for (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane is C[C@H]1O[C@]2(C)CCC[C@H]1O2.
What is the InChIKey of (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
The InChIKey is LYVSKAUJEKUBNH-PRJMDXOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-6-7-4-3-5-8(2,9-6)10-7/h6-7H,3-5H2,1-2H3/t6-,7-,8+/m1/s1.
What are the key properties of (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
(1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane has a molecular weight of 142.20 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S,7R)-5,7-dimethyl-6,8-dioxabicyclo[3.2.1]octane is sourced from PubChem (CID 12644663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).