C15H25N5O3S — CID 126446748
(3S)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide (PubChem CID 126446748) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is (3S)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126446748 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (3S)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
| SMILES | NS(=O)(=O)C[C@H]1CCN(C(=O)NCc2n[nH]c3c2CCCCC3)C1 |
| InChI | InChI=1S/C15H25N5O3S/c16-24(22,23)10-11-6-7-20(9-11)15(21)17-8-14-12-4-2-1-3-5-13(12)18-19-14/h11H,1-10H2,(H,17,21)(H,18,19)(H2,16,22,23)/t11-/m0/s1 |
| InChIKey | JHNDBAWAFSAGLM-NSHDSACASA-N |
| XLogP | 0.50 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |