C12H18N4O — CID 126446909
(3R)-3-ethenyl-N-[2-(1H-imidazol-5-yl)ethyl]pyrrolidine-1-carboxamide (PubChem CID 126446909) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is (3R)-3-ethenyl-N-[2-(1H-imidazol-5-yl)ethyl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-ethenyl-N-[2-(1H-imidazol-5-yl)ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126446909 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (3R)-3-ethenyl-N-[2-(1H-imidazol-5-yl)ethyl]pyrrolidine-1-carboxamide |
| SMILES | C=C[C@H]1CCN(C(=O)NCCc2cnc[nH]2)C1 |
| InChI | InChI=1S/C12H18N4O/c1-2-10-4-6-16(8-10)12(17)14-5-3-11-7-13-9-15-11/h2,7,9-10H,1,3-6,8H2,(H,13,15)(H,14,17)/t10-/m0/s1 |
| InChIKey | XLISEKMKFLICOY-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|