C11H18N4O3S — CID 126447208
(2R)-2-[[2-(5-amino-3-methylpyrazol-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 126447208) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is (2R)-2-[[2-(5-amino-3-methylpyrazol-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[2-(5-amino-3-methylpyrazol-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 126447208 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2R)-2-[[2-(5-amino-3-methylpyrazol-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)Cn1nc(C)cc1N)C(=O)O |
| InChI | InChI=1S/C11H18N4O3S/c1-7-5-9(12)15(14-7)6-10(16)13-8(11(17)18)3-4-19-2/h5,8H,3-4,6,12H2,1-2H3,(H,13,16)(H,17,18)/t8-/m1/s1 |
| InChIKey | GOHYPSSEEWPIOK-MRVPVSSYSA-N |
| XLogP | 0.10 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |