C20H25N3O2S — CID 126448230
(3R)-N,N-diethyl-1-[3-(1,3-thiazol-2-yl)benzoyl]piperidine-3-carboxamide (PubChem CID 126448230) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is (3R)-N,N-diethyl-1-[3-(1,3-thiazol-2-yl)benzoyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N,N-diethyl-1-[3-(1,3-thiazol-2-yl)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126448230 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (3R)-N,N-diethyl-1-[3-(1,3-thiazol-2-yl)benzoyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN(C(=O)c2cccc(-c3nccs3)c2)C1 |
| InChI | InChI=1S/C20H25N3O2S/c1-3-22(4-2)20(25)17-9-6-11-23(14-17)19(24)16-8-5-7-15(13-16)18-21-10-12-26-18/h5,7-8,10,12-13,17H,3-4,6,9,11,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | COSPTINSDCEBAV-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |