C18H31N5 — CID 126448998
4-ethyl-5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazin-1-yl]pyrimidine (PubChem CID 126448998) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is 4-ethyl-5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-ethyl-5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126448998 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 4-ethyl-5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]methyl]piperazin-1-yl]pyrimidine |
| SMILES | CCc1nc(N2CCN(C[C@@H]3CCCN(C)C3)CC2)ncc1C |
| InChI | InChI=1S/C18H31N5/c1-4-17-15(2)12-19-18(20-17)23-10-8-22(9-11-23)14-16-6-5-7-21(3)13-16/h12,16H,4-11,13-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | KINZHCBVHILPTE-MRXNPFEDSA-N |
| XLogP | 1.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |