C21H21FN2O2 — CID 126449152
4-(3-cyano-4-fluorophenyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]benzamide (PubChem CID 126449152) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-(3-cyano-4-fluorophenyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]benzamide.
| Compound Name | 4-(3-cyano-4-fluorophenyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126449152 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-(3-cyano-4-fluorophenyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]benzamide |
| SMILES | CN(C[C@H]1CCCCO1)C(=O)c1ccc(-c2ccc(F)c(C#N)c2)cc1 |
| InChI | InChI=1S/C21H21FN2O2/c1-24(14-19-4-2-3-11-26-19)21(25)16-7-5-15(6-8-16)17-9-10-20(22)18(12-17)13-23/h5-10,12,19H,2-4,11,14H2,1H3/t19-/m1/s1 |
| InChIKey | GCXXXTBIMXGIBM-LJQANCHMSA-N |
| XLogP | 4.01 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |