C24H24FNO2 — CID 175641343
6-(3-fluoro-2-methylphenyl)-N-methyl-N-(oxolan-2-ylmethyl)naphthalene-2-carboxamide (PubChem CID 175641343) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 6-(3-fluoro-2-methylphenyl)-N-methyl-N-(oxolan-2-ylmethyl)naphthalene-2-carboxamide.
| Compound Name | 6-(3-fluoro-2-methylphenyl)-N-methyl-N-(oxolan-2-ylmethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 175641343 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 6-(3-fluoro-2-methylphenyl)-N-methyl-N-(oxolan-2-ylmethyl)naphthalene-2-carboxamide |
| SMILES | Cc1c(F)cccc1-c1ccc2cc(C(=O)N(C)CC3CCCO3)ccc2c1 |
| InChI | InChI=1S/C24H24FNO2/c1-16-22(6-3-7-23(16)25)19-10-8-18-14-20(11-9-17(18)13-19)24(27)26(2)15-21-5-4-12-28-21/h3,6-11,13-14,21H,4-5,12,15H2,1-2H3 |
| InChIKey | AQLUSQKDDZFTFX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |