C18H23N3O3 — CID 126450614
(3S)-3-[[isoquinolin-5-ylmethyl(methyl)carbamoyl]amino]-4-methylpentanoic acid (PubChem CID 126450614) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3S)-3-[[isoquinolin-5-ylmethyl(methyl)carbamoyl]amino]-4-methylpentanoic acid.
| Compound Name | (3S)-3-[[isoquinolin-5-ylmethyl(methyl)carbamoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 126450614 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3S)-3-[[isoquinolin-5-ylmethyl(methyl)carbamoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)[C@H](CC(=O)O)NC(=O)N(C)Cc1cccc2cnccc12 |
| InChI | InChI=1S/C18H23N3O3/c1-12(2)16(9-17(22)23)20-18(24)21(3)11-14-6-4-5-13-10-19-8-7-15(13)14/h4-8,10,12,16H,9,11H2,1-3H3,(H,20,24)(H,22,23)/t16-/m0/s1 |
| InChIKey | QIESEEHECAQJAR-INIZCTEOSA-N |
| XLogP | 2.88 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |