C22H23N3O3 — CID 97193338
(2S)-2-[4-(dimethylcarbamoyl)phenyl]-2-[isoquinolin-5-ylmethyl(methyl)amino]acetic acid (PubChem CID 97193338) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S)-2-[4-(dimethylcarbamoyl)phenyl]-2-[isoquinolin-5-ylmethyl(methyl)amino]acetic acid.
| Compound Name | (2S)-2-[4-(dimethylcarbamoyl)phenyl]-2-[isoquinolin-5-ylmethyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 97193338 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2S)-2-[4-(dimethylcarbamoyl)phenyl]-2-[isoquinolin-5-ylmethyl(methyl)amino]acetic acid |
| SMILES | CN(C)C(=O)c1ccc([C@@H](C(=O)O)N(C)Cc2cccc3cnccc23)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-24(2)21(26)16-9-7-15(8-10-16)20(22(27)28)25(3)14-18-6-4-5-17-13-23-12-11-19(17)18/h4-13,20H,14H2,1-3H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | INRFZFGGSIHGJO-FQEVSTJZSA-N |
| XLogP | 3.19 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |