C19H28N2O4 — CID 126451892
(3R)-3-[(4-hydroxy-4-phenylpiperidine-1-carbonyl)amino]-5-methylhexanoic acid (PubChem CID 126451892) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (3R)-3-[(4-hydroxy-4-phenylpiperidine-1-carbonyl)amino]-5-methylhexanoic acid.
| Compound Name | (3R)-3-[(4-hydroxy-4-phenylpiperidine-1-carbonyl)amino]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 126451892 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (3R)-3-[(4-hydroxy-4-phenylpiperidine-1-carbonyl)amino]-5-methylhexanoic acid |
| SMILES | CC(C)C[C@H](CC(=O)O)NC(=O)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-14(2)12-16(13-17(22)23)20-18(24)21-10-8-19(25,9-11-21)15-6-4-3-5-7-15/h3-7,14,16,25H,8-13H2,1-2H3,(H,20,24)(H,22,23)/t16-/m1/s1 |
| InChIKey | ZRQOKKHUAJGMCB-MRXNPFEDSA-N |
| XLogP | 2.57 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |