C19H30N2O3 — CID 126452399
3-(cyclohexylmethyl)-1-ethyl-1-[(2R)-2-hydroxy-3-phenoxypropyl]urea (PubChem CID 126452399) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-1-ethyl-1-[(2R)-2-hydroxy-3-phenoxypropyl]urea.
| Compound Name | 3-(cyclohexylmethyl)-1-ethyl-1-[(2R)-2-hydroxy-3-phenoxypropyl]urea |
|---|---|
| PubChem CID | 126452399 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 3-(cyclohexylmethyl)-1-ethyl-1-[(2R)-2-hydroxy-3-phenoxypropyl]urea |
| SMILES | CCN(C[C@@H](O)COc1ccccc1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-21(19(23)20-13-16-9-5-3-6-10-16)14-17(22)15-24-18-11-7-4-8-12-18/h4,7-8,11-12,16-17,22H,2-3,5-6,9-10,13-15H2,1H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | KRBBDTXZUKOBIE-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |