C19H29NO4 — CID 122136474
2-cyclopropyl-N-ethyl-N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]acetamide (PubChem CID 122136474) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-cyclopropyl-N-ethyl-N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]acetamide.
| Compound Name | 2-cyclopropyl-N-ethyl-N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]acetamide |
|---|---|
| PubChem CID | 122136474 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-cyclopropyl-N-ethyl-N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]acetamide |
| SMILES | CCN(CC(O)COc1ccc(CCOC)cc1)C(=O)CC1CC1 |
| InChI | InChI=1S/C19H29NO4/c1-3-20(19(22)12-16-4-5-16)13-17(21)14-24-18-8-6-15(7-9-18)10-11-23-2/h6-9,16-17,21H,3-5,10-14H2,1-2H3 |
| InChIKey | KFBJVOISINLNGT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |