C21H33N3O2 — CID 126454384
1-[(2R)-2-hydroxy-3-phenylpropyl]-3-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]urea (PubChem CID 126454384) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-phenylpropyl]-3-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]urea.
| Compound Name | 1-[(2R)-2-hydroxy-3-phenylpropyl]-3-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 126454384 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-phenylpropyl]-3-[1-(pyrrolidin-1-ylmethyl)cyclohexyl]urea |
| SMILES | O=C(NC[C@H](O)Cc1ccccc1)NC1(CN2CCCC2)CCCCC1 |
| InChI | InChI=1S/C21H33N3O2/c25-19(15-18-9-3-1-4-10-18)16-22-20(26)23-21(11-5-2-6-12-21)17-24-13-7-8-14-24/h1,3-4,9-10,19,25H,2,5-8,11-17H2,(H2,22,23,26)/t19-/m1/s1 |
| InChIKey | QLFGEKJADHDINH-LJQANCHMSA-N |
| XLogP | 2.69 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |