C21H29N3O — CID 126454579
(2S,4R)-2-(3-methylimidazol-4-yl)-N-[(1R,2R)-2-phenylcyclohexyl]oxan-4-amine (PubChem CID 126454579) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S,4R)-2-(3-methylimidazol-4-yl)-N-[(1R,2R)-2-phenylcyclohexyl]oxan-4-amine.
| Compound Name | (2S,4R)-2-(3-methylimidazol-4-yl)-N-[(1R,2R)-2-phenylcyclohexyl]oxan-4-amine |
|---|---|
| PubChem CID | 126454579 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (2S,4R)-2-(3-methylimidazol-4-yl)-N-[(1R,2R)-2-phenylcyclohexyl]oxan-4-amine |
| SMILES | Cn1cncc1[C@@H]1C[C@H](N[C@@H]2CCCC[C@@H]2c2ccccc2)CCO1 |
| InChI | InChI=1S/C21H29N3O/c1-24-15-22-14-20(24)21-13-17(11-12-25-21)23-19-10-6-5-9-18(19)16-7-3-2-4-8-16/h2-4,7-8,14-15,17-19,21,23H,5-6,9-13H2,1H3/t17-,18-,19-,21+/m1/s1 |
| InChIKey | WGZSAKBIWLMRRS-XCJLJZCSSA-N |
| XLogP | 3.96 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |