C17H24ClNO6 — CID 126456729
1-[(2-chlorophenyl)methoxy]-3-(cyclopentylamino)propan-2-ol;oxalic acid (PubChem CID 126456729) has the molecular formula C17H24ClNO6 and a molecular weight of 373.83 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methoxy]-3-(cyclopentylamino)propan-2-ol;oxalic acid.
| Compound Name | 1-[(2-chlorophenyl)methoxy]-3-(cyclopentylamino)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 126456729 |
| Molecular Formula | C17H24ClNO6 |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methoxy]-3-(cyclopentylamino)propan-2-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(CNC1CCCC1)COCc1ccccc1Cl |
| InChI | InChI=1S/C15H22ClNO2.C2H2O4/c16-15-8-4-1-5-12(15)10-19-11-14(18)9-17-13-6-2-3-7-13;3-1(4)2(5)6/h1,4-5,8,13-14,17-18H,2-3,6-7,9-11H2;(H,3,4)(H,5,6) |
| InChIKey | HUYFUAYGRVSMAS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|