C22H21N3O2 — CID 126458147
N-benzyl-N,2,9-trimethyl-1-oxopyrido[3,4-b]indole-4-carboxamide (PubChem CID 126458147) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-benzyl-N,2,9-trimethyl-1-oxopyrido[3,4-b]indole-4-carboxamide.
| Compound Name | N-benzyl-N,2,9-trimethyl-1-oxopyrido[3,4-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 126458147 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-benzyl-N,2,9-trimethyl-1-oxopyrido[3,4-b]indole-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cn(C)c(=O)c2c1c1ccccc1n2C |
| InChI | InChI=1S/C22H21N3O2/c1-23(13-15-9-5-4-6-10-15)21(26)17-14-24(2)22(27)20-19(17)16-11-7-8-12-18(16)25(20)3/h4-12,14H,13H2,1-3H3 |
| InChIKey | FZZVIUPQIBGMCO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |