C19H19N3O3 — CID 46356937
N-benzyl-N-methyl-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide (PubChem CID 46356937) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide.
| Compound Name | N-benzyl-N-methyl-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 46356937 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-benzyl-N-methyl-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cn1c(=O)c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C19H19N3O3/c1-20(12-14-8-4-3-5-9-14)17(23)13-22-16-11-7-6-10-15(16)21(2)18(24)19(22)25/h3-11H,12-13H2,1-2H3 |
| InChIKey | RVQCPFXFKGYUOF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|