C23H28N4O3 — CID 92752265
N-[(2R)-1-[benzyl(methyl)amino]butan-2-yl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide (PubChem CID 92752265) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[(2R)-1-[benzyl(methyl)amino]butan-2-yl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[(2R)-1-[benzyl(methyl)amino]butan-2-yl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 92752265 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[(2R)-1-[benzyl(methyl)amino]butan-2-yl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
| SMILES | CC[C@H](CN(C)Cc1ccccc1)NC(=O)Cn1c(=O)c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C23H28N4O3/c1-4-18(15-25(2)14-17-10-6-5-7-11-17)24-21(28)16-27-20-13-9-8-12-19(20)26(3)22(29)23(27)30/h5-13,18H,4,14-16H2,1-3H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | OBEPYEKMHKQJNS-GOSISDBHSA-N |
| XLogP | 1.73 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|