C17H22N4O3S — CID 126458568
N-[2-(4-sulfamoylphenyl)ethyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide (PubChem CID 126458568) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
|---|---|
| PubChem CID | 126458568 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)Cn2cc3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c18-25(23,24)15-7-5-13(6-8-15)9-10-19-17(22)12-21-11-14-3-1-2-4-16(14)20-21/h5-8,11H,1-4,9-10,12H2,(H,19,22)(H2,18,23,24) |
| InChIKey | ZPXGGEDRKUJASG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |