C20H22N2O4S2 — CID 126459779
3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]-N-(3-phenylpropyl)propanamide (PubChem CID 126459779) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 126459779 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 3-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]-N-(3-phenylpropyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc2c(c1)SCC(=O)N2)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O4S2/c23-19(21-11-4-7-15-5-2-1-3-6-15)10-12-28(25,26)16-8-9-17-18(13-16)27-14-20(24)22-17/h1-3,5-6,8-9,13H,4,7,10-12,14H2,(H,21,23)(H,22,24) |
| InChIKey | BDUUXKXXLXWNKF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|