C25H26N4O2S — CID 126460276
(3R,7S,8aS)-3-(benzylsulfanylmethyl)-7-(quinolin-6-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126460276) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is (3R,7S,8aS)-3-(benzylsulfanylmethyl)-7-(quinolin-6-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,7S,8aS)-3-(benzylsulfanylmethyl)-7-(quinolin-6-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126460276 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3R,7S,8aS)-3-(benzylsulfanylmethyl)-7-(quinolin-6-ylmethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@@H](CSCc2ccccc2)C(=O)N2C[C@@H](NCc3ccc4ncccc4c3)C[C@@H]12 |
| InChI | InChI=1S/C25H26N4O2S/c30-24-23-12-20(27-13-18-8-9-21-19(11-18)7-4-10-26-21)14-29(23)25(31)22(28-24)16-32-15-17-5-2-1-3-6-17/h1-11,20,22-23,27H,12-16H2,(H,28,30)/t20-,22-,23-/m0/s1 |
| InChIKey | HTXZQVJGUDKYRL-PMVMPFDFSA-N |
| XLogP | 2.73 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |