C19H25ClN2O3 — CID 126462190
methyl (2S)-1-[1-[(3-chlorophenyl)methyl]-7-oxoazepan-4-yl]pyrrolidine-2-carboxylate (PubChem CID 126462190) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is methyl (2S)-1-[1-[(3-chlorophenyl)methyl]-7-oxoazepan-4-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[1-[(3-chlorophenyl)methyl]-7-oxoazepan-4-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 126462190 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl (2S)-1-[1-[(3-chlorophenyl)methyl]-7-oxoazepan-4-yl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C1CCC(=O)N(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H25ClN2O3/c1-25-19(24)17-6-3-10-22(17)16-7-8-18(23)21(11-9-16)13-14-4-2-5-15(20)12-14/h2,4-5,12,16-17H,3,6-11,13H2,1H3/t16?,17-/m0/s1 |
| InChIKey | GZGQLLMVJSAGKK-DJNXLDHESA-N |
| XLogP | 2.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |