C11H14Cl2N2O — CID 10934236
[(3S)-1-[(3-chlorophenyl)methyl]-2-oxopyrrolidin-3-yl]azanium chloride (PubChem CID 10934236) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is [(3S)-1-[(3-chlorophenyl)methyl]-2-oxopyrrolidin-3-yl]azanium chloride.
| Compound Name | [(3S)-1-[(3-chlorophenyl)methyl]-2-oxopyrrolidin-3-yl]azanium chloride |
|---|---|
| PubChem CID | 10934236 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [(3S)-1-[(3-chlorophenyl)methyl]-2-oxopyrrolidin-3-yl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@H]1CCN(Cc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C11H13ClN2O.ClH/c12-9-3-1-2-8(6-9)7-14-5-4-10(13)11(14)15;/h1-3,6,10H,4-5,7,13H2;1H/t10-;/m0./s1 |
| InChIKey | ZBOBEDRZCOYYAL-PPHPATTJSA-N |
| XLogP | -2.31 |
| TPSA | 47.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |