C15H18Cl3NO — CID 19898311
3-chloro-4-(1-chlorobutyl)-1-[(3-chlorophenyl)methyl]pyrrolidin-2-one (PubChem CID 19898311) has the molecular formula C15H18Cl3NO and a molecular weight of 334.67 g/mol. Its IUPAC name is 3-chloro-4-(1-chlorobutyl)-1-[(3-chlorophenyl)methyl]pyrrolidin-2-one.
| Compound Name | 3-chloro-4-(1-chlorobutyl)-1-[(3-chlorophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 19898311 |
| Molecular Formula | C15H18Cl3NO |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-chloro-4-(1-chlorobutyl)-1-[(3-chlorophenyl)methyl]pyrrolidin-2-one |
| SMILES | CCCC(Cl)C1CN(Cc2cccc(Cl)c2)C(=O)C1Cl |
| InChI | InChI=1S/C15H18Cl3NO/c1-2-4-13(17)12-9-19(15(20)14(12)18)8-10-5-3-6-11(16)7-10/h3,5-7,12-14H,2,4,8-9H2,1H3 |
| InChIKey | KUBVFIILTMQXJJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|