C21H19FN4O3 — CID 126465677
N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 126465677) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 126465677 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | Cc1cnc(C)c(-c2cc(F)cc3c2OC(CNC(=O)c2ccc[n+]([O-])c2)C3)n1 |
| InChI | InChI=1S/C21H19FN4O3/c1-12-9-23-13(2)19(25-12)18-8-16(22)6-15-7-17(29-20(15)18)10-24-21(27)14-4-3-5-26(28)11-14/h3-6,8-9,11,17H,7,10H2,1-2H3,(H,24,27) |
| InChIKey | IYGOWVYFKNJHJO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|