C21H24FN3O2 — CID 45179383
(E)-N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylpent-2-enamide (PubChem CID 45179383) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is (E)-N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylpent-2-enamide.
| Compound Name | (E)-N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 45179383 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (E)-N-[[7-(3,6-dimethylpyrazin-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylpent-2-enamide |
| SMILES | Cc1cnc(C)c(-c2cc(F)cc3c2OC(CNC(=O)/C=C/C(C)C)C3)n1 |
| InChI | InChI=1S/C21H24FN3O2/c1-12(2)5-6-19(26)24-11-17-8-15-7-16(22)9-18(21(15)27-17)20-14(4)23-10-13(3)25-20/h5-7,9-10,12,17H,8,11H2,1-4H3,(H,24,26)/b6-5+ |
| InChIKey | XRKVXBUPFPIFBS-AATRIKPKSA-N |
| XLogP | 3.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|