C18H19N3O2 — CID 126467343
N-[(7-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]pent-4-enamide (PubChem CID 126467343) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[(7-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]pent-4-enamide.
| Compound Name | N-[(7-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]pent-4-enamide |
|---|---|
| PubChem CID | 126467343 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[(7-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NCC1Cc2cccc(-c3cncnc3)c2O1 |
| InChI | InChI=1S/C18H19N3O2/c1-2-3-7-17(22)21-11-15-8-13-5-4-6-16(18(13)23-15)14-9-19-12-20-10-14/h2,4-6,9-10,12,15H,1,3,7-8,11H2,(H,21,22) |
| InChIKey | PHJGHQLOILKRSN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|