C18H18ClN3O2 — CID 42468137
N-[[(2R)-7-chloro-5-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]pent-4-enamide (PubChem CID 42468137) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is N-[[(2R)-7-chloro-5-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]pent-4-enamide.
| Compound Name | N-[[(2R)-7-chloro-5-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 42468137 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[[(2R)-7-chloro-5-pyrimidin-5-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC[C@H]1Cc2cc(-c3cncnc3)cc(Cl)c2O1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-2-3-4-17(23)22-10-15-6-13-5-12(7-16(19)18(13)24-15)14-8-20-11-21-9-14/h2,5,7-9,11,15H,1,3-4,6,10H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | XWUBKTVDCQYLIR-OAHLLOKOSA-N |
| XLogP | 3.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|