C22H33N3O4 — CID 126467345
2,6-dimethoxy-N-[[8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 126467345) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[[8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dimethoxy-N-[[8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126467345 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2,6-dimethoxy-N-[[8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NCC2CCC3(CCN(CC=C(C)C)CC3)O2)c(OC)n1 |
| InChI | InChI=1S/C22H33N3O4/c1-16(2)8-12-25-13-10-22(11-14-25)9-7-17(29-22)15-23-20(26)18-5-6-19(27-3)24-21(18)28-4/h5-6,8,17H,7,9-15H2,1-4H3,(H,23,26) |
| InChIKey | GZESCVVHWWQXHW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|