C20H30N4O3 — CID 125179435
1-[[(2S)-8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-3-(2-oxo-1H-pyridin-3-yl)urea (PubChem CID 125179435) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[[(2S)-8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-3-(2-oxo-1H-pyridin-3-yl)urea.
| Compound Name | 1-[[(2S)-8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-3-(2-oxo-1H-pyridin-3-yl)urea |
|---|---|
| PubChem CID | 125179435 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-[[(2S)-8-(3-methylbut-2-enyl)-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]-3-(2-oxo-1H-pyridin-3-yl)urea |
| SMILES | CC(C)=CCN1CCC2(CC[C@@H](CNC(=O)Nc3ccc[nH]c3=O)O2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-15(2)6-11-24-12-8-20(9-13-24)7-5-16(27-20)14-22-19(26)23-17-4-3-10-21-18(17)25/h3-4,6,10,16H,5,7-9,11-14H2,1-2H3,(H,21,25)(H2,22,23,26)/t16-/m0/s1 |
| InChIKey | ZFKVMEXQLQWOPC-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|