C16H25N3O4S — CID 126468134
(2,6-dimethylpiperidin-1-yl)-[(3R,5S)-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]methanone (PubChem CID 126468134) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-[(3R,5S)-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]methanone.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-[(3R,5S)-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 126468134 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-[(3R,5S)-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]methanone |
| SMILES | CC1CCCC(C)N1C(=O)[C@H]1C[C@@H](c2ccco2)NS(=O)(=O)N1C |
| InChI | InChI=1S/C16H25N3O4S/c1-11-6-4-7-12(2)19(11)16(20)14-10-13(15-8-5-9-23-15)17-24(21,22)18(14)3/h5,8-9,11-14,17H,4,6-7,10H2,1-3H3/t11?,12?,13-,14+/m0/s1 |
| InChIKey | QWRCQGZGUYEQAN-CLRIEMFWSA-N |
| XLogP | 1.65 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |