C22H27N5O4S — CID 46950438
(3R,5S)-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 46950438) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is (3R,5S)-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 46950438 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (3R,5S)-N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1ccc(Cn2nc(C)c(NC(=O)[C@H]3C[C@@H](c4ccco4)NS(=O)(=O)N3C)c2C)cc1 |
| InChI | InChI=1S/C22H27N5O4S/c1-14-7-9-17(10-8-14)13-27-16(3)21(15(2)24-27)23-22(28)19-12-18(20-6-5-11-31-20)25-32(29,30)26(19)4/h5-11,18-19,25H,12-13H2,1-4H3,(H,23,28)/t18-,19+/m0/s1 |
| InChIKey | XELMHQAQYPIAKW-RBUKOAKNSA-N |
| XLogP | 2.67 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |