C21H27N7O3S — CID 99888427
(3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-2-methyl-N-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 99888427) has the molecular formula C21H27N7O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is (3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-2-methyl-N-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-2-methyl-N-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 99888427 |
| Molecular Formula | C21H27N7O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-2-methyl-N-[1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1ccc(Cn2ccc(NC(=O)[C@@H]3C[C@@H](c4cnn(C)c4C)NS(=O)(=O)N3C)n2)cc1 |
| InChI | InChI=1S/C21H27N7O3S/c1-14-5-7-16(8-6-14)13-28-10-9-20(24-28)23-21(29)19-11-18(25-32(30,31)27(19)4)17-12-22-26(3)15(17)2/h5-10,12,18-19,25H,11,13H2,1-4H3,(H,23,24,29)/t18-,19-/m0/s1 |
| InChIKey | OVJQHCMRKIUYCW-OALUTQOASA-N |
| XLogP | 1.50 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |