C15H20N6O3S — CID 95797818
(3S,5S)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-N-pyridin-3-yl-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 95797818) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is (3S,5S)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-N-pyridin-3-yl-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5S)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-N-pyridin-3-yl-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 95797818 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (3S,5S)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-N-pyridin-3-yl-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1nn(C)cc1[C@@H]1C[C@@H](C(=O)Nc2cccnc2)N(C)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H20N6O3S/c1-10-12(9-20(2)18-10)13-7-14(21(3)25(23,24)19-13)15(22)17-11-5-4-6-16-8-11/h4-6,8-9,13-14,19H,7H2,1-3H3,(H,17,22)/t13-,14-/m0/s1 |
| InChIKey | CDUGGOMFEOMSAJ-KBPBESRZSA-N |
| XLogP | 0.34 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |