C22H37N5O3S — CID 46950455
(3R,5S)-N,N-dicyclohexyl-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 46950455) has the molecular formula C22H37N5O3S and a molecular weight of 451.64 g/mol. Its IUPAC name is (3R,5S)-N,N-dicyclohexyl-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N,N-dicyclohexyl-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 46950455 |
| Molecular Formula | C22H37N5O3S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (3R,5S)-N,N-dicyclohexyl-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1nn(C)cc1[C@@H]1C[C@H](C(=O)N(C2CCCCC2)C2CCCCC2)N(C)S(=O)(=O)N1 |
| InChI | InChI=1S/C22H37N5O3S/c1-16-19(15-25(2)23-16)20-14-21(26(3)31(29,30)24-20)22(28)27(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h15,17-18,20-21,24H,4-14H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | GOZNFZDZAQSTHB-LEWJYISDSA-N |
| XLogP | 2.80 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |