C16H20ClN5O4S — CID 95797797
(3S,5R)-N-(5-chloro-2-hydroxyphenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 95797797) has the molecular formula C16H20ClN5O4S and a molecular weight of 413.89 g/mol. Its IUPAC name is (3S,5R)-N-(5-chloro-2-hydroxyphenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(5-chloro-2-hydroxyphenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 95797797 |
| Molecular Formula | C16H20ClN5O4S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (3S,5R)-N-(5-chloro-2-hydroxyphenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1nn(C)cc1[C@H]1C[C@@H](C(=O)Nc2cc(Cl)ccc2O)N(C)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H20ClN5O4S/c1-9-11(8-21(2)19-9)12-7-14(22(3)27(25,26)20-12)16(24)18-13-6-10(17)4-5-15(13)23/h4-6,8,12,14,20,23H,7H2,1-3H3,(H,18,24)/t12-,14+/m1/s1 |
| InChIKey | FWKVXQKZHGGVSU-OCCSQVGLSA-N |
| XLogP | 1.31 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|