C16H19F2N5O3S — CID 110214181
N-(2,4-difluorophenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 110214181) has the molecular formula C16H19F2N5O3S and a molecular weight of 399.42 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 110214181 |
| Molecular Formula | C16H19F2N5O3S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1nn(C)cc1C1CC(C(=O)Nc2ccc(F)cc2F)N(C)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H19F2N5O3S/c1-9-11(8-22(2)20-9)14-7-15(23(3)27(25,26)21-14)16(24)19-13-5-4-10(17)6-12(13)18/h4-6,8,14-15,21H,7H2,1-3H3,(H,19,24) |
| InChIKey | ZTQCEVPEQGCVEP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |