C15H15F2N3O3S2 — CID 100576098
(3S,5S)-N-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 100576098) has the molecular formula C15H15F2N3O3S2 and a molecular weight of 387.43 g/mol. Its IUPAC name is (3S,5S)-N-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5S)-N-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 100576098 |
| Molecular Formula | C15H15F2N3O3S2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (3S,5S)-N-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2ccc(F)cc2F)C[C@@H](c2cccs2)NS1(=O)=O |
| InChI | InChI=1S/C15H15F2N3O3S2/c1-20-13(15(21)18-11-5-4-9(16)7-10(11)17)8-12(19-25(20,22)23)14-3-2-6-24-14/h2-7,12-13,19H,8H2,1H3,(H,18,21)/t12-,13-/m0/s1 |
| InChIKey | PCZGWKDHHXVRHB-STQMWFEESA-N |
| XLogP | 2.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |