C15H16FN3OS2 — CID 142420063
(3R,5S)-N-(4-fluorophenyl)-2-methyl-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 142420063) has the molecular formula C15H16FN3OS2 and a molecular weight of 337.45 g/mol. Its IUPAC name is (3R,5S)-N-(4-fluorophenyl)-2-methyl-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-(4-fluorophenyl)-2-methyl-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 142420063 |
| Molecular Formula | C15H16FN3OS2 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (3R,5S)-N-(4-fluorophenyl)-2-methyl-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1SN[C@H](c2cccs2)C[C@@H]1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FN3OS2/c1-19-13(9-12(18-22-19)14-3-2-8-21-14)15(20)17-11-6-4-10(16)5-7-11/h2-8,12-13,18H,9H2,1H3,(H,17,20)/t12-,13+/m0/s1 |
| InChIKey | IZZAJOKHAXBRMI-QWHCGFSZSA-N |
| XLogP | 3.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|