C17H16BrF2N3OS — CID 156758364
(3R,5S)-N-(3-bromo-4-fluorophenyl)-5-(4-fluorophenyl)-2-methyl-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 156758364) has the molecular formula C17H16BrF2N3OS and a molecular weight of 428.30 g/mol. Its IUPAC name is (3R,5S)-N-(3-bromo-4-fluorophenyl)-5-(4-fluorophenyl)-2-methyl-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-(3-bromo-4-fluorophenyl)-5-(4-fluorophenyl)-2-methyl-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 156758364 |
| Molecular Formula | C17H16BrF2N3OS |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | (3R,5S)-N-(3-bromo-4-fluorophenyl)-5-(4-fluorophenyl)-2-methyl-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1SN[C@H](c2ccc(F)cc2)C[C@@H]1C(=O)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H16BrF2N3OS/c1-23-16(17(24)21-12-6-7-14(20)13(18)8-12)9-15(22-25-23)10-2-4-11(19)5-3-10/h2-8,15-16,22H,9H2,1H3,(H,21,24)/t15-,16+/m0/s1 |
| InChIKey | LUHYXCLBRBJIPK-JKSUJKDBSA-N |
| XLogP | 4.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|