C17H21N3O5S2 — CID 16670767
(3R,5S)-N-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 16670767) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (3R,5S)-N-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 16670767 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (3R,5S)-N-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-5-thiophen-2-yl-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2C[C@@H](c3cccs3)NS(=O)(=O)N2C)cc1OC |
| InChI | InChI=1S/C17H21N3O5S2/c1-20-13(10-12(19-27(20,22)23)16-5-4-8-26-16)17(21)18-11-6-7-14(24-2)15(9-11)25-3/h4-9,12-13,19H,10H2,1-3H3,(H,18,21)/t12-,13+/m0/s1 |
| InChIKey | AVLYNBRCVVOYCN-QWHCGFSZSA-N |
| XLogP | 1.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |