C18H25N5O4S — CID 95797892
(3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-N-[4-[(1R)-1-hydroxyethyl]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 95797892) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is (3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-N-[4-[(1R)-1-hydroxyethyl]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-N-[4-[(1R)-1-hydroxyethyl]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 95797892 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (3S,5S)-5-(1,5-dimethylpyrazol-4-yl)-N-[4-[(1R)-1-hydroxyethyl]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1c([C@@H]2C[C@@H](C(=O)Nc3ccc([C@@H](C)O)cc3)N(C)S(=O)(=O)N2)cnn1C |
| InChI | InChI=1S/C18H25N5O4S/c1-11-15(10-19-22(11)3)16-9-17(23(4)28(26,27)21-16)18(25)20-14-7-5-13(6-8-14)12(2)24/h5-8,10,12,16-17,21,24H,9H2,1-4H3,(H,20,25)/t12-,16+,17+/m1/s1 |
| InChIKey | MLMQENGKXDIICV-DQYPLSBCSA-N |
| XLogP | 1.00 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |