C19H22FN7O4S — CID 167380628
3-N-(3-cyano-4-fluorophenyl)-5-N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide (PubChem CID 167380628) has the molecular formula C19H22FN7O4S and a molecular weight of 463.50 g/mol. Its IUPAC name is 3-N-(3-cyano-4-fluorophenyl)-5-N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide.
| Compound Name | 3-N-(3-cyano-4-fluorophenyl)-5-N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide |
|---|---|
| PubChem CID | 167380628 |
| Molecular Formula | C19H22FN7O4S |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-N-(3-cyano-4-fluorophenyl)-5-N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dicarboxamide |
| SMILES | Cc1c(CNC(=O)C2CC(C(=O)Nc3ccc(F)c(C#N)c3)N(C)S(=O)(=O)N2)cnn1C |
| InChI | InChI=1S/C19H22FN7O4S/c1-11-13(10-23-26(11)2)9-22-18(28)16-7-17(27(3)32(30,31)25-16)19(29)24-14-4-5-15(20)12(6-14)8-21/h4-6,10,16-17,25H,7,9H2,1-3H3,(H,22,28)(H,24,29) |
| InChIKey | CCXGTWAIMSOMHK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 149.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |