C19H18FN7O3S2 — CID 135317096
(3R,5S)-N-(3-cyano-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317096) has the molecular formula C19H18FN7O3S2 and a molecular weight of 475.53 g/mol. Its IUPAC name is (3R,5S)-N-(3-cyano-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-N-(3-cyano-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317096 |
| Molecular Formula | C19H18FN7O3S2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (3R,5S)-N-(3-cyano-4-fluorophenyl)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@@H](C(=O)Nc2ccc(F)c(C#N)c2)C[C@@H](c2ncc(-c3cnn(C)c3)s2)NS1(=O)=O |
| InChI | InChI=1S/C19H18FN7O3S2/c1-26-10-12(8-23-26)17-9-22-19(31-17)15-6-16(27(2)32(29,30)25-15)18(28)24-13-3-4-14(20)11(5-13)7-21/h3-5,8-10,15-16,25H,6H2,1-2H3,(H,24,28)/t15-,16+/m0/s1 |
| InChIKey | XSTATENWCGGASW-JKSUJKDBSA-N |
| XLogP | 1.77 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |