C19H17ClFN5O3S2 — CID 135316475
(3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(5-pyridin-2-yl-1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135316475) has the molecular formula C19H17ClFN5O3S2 and a molecular weight of 481.96 g/mol. Its IUPAC name is (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(5-pyridin-2-yl-1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(5-pyridin-2-yl-1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135316475 |
| Molecular Formula | C19H17ClFN5O3S2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-5-(5-pyridin-2-yl-1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@H](c2ncc(-c3ccccn3)s2)NS1(=O)=O |
| InChI | InChI=1S/C19H17ClFN5O3S2/c1-26-16(18(27)24-11-5-6-13(21)12(20)8-11)9-15(25-31(26,28)29)19-23-10-17(30-19)14-4-2-3-7-22-14/h2-8,10,15-16,25H,9H2,1H3,(H,24,27)/t15-,16+/m1/s1 |
| InChIKey | LPACOPOVXZGCMH-CVEARBPZSA-N |
| XLogP | 3.22 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |