C18H17F3N6O3S2 — CID 135317075
(3S,5R)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317075) has the molecular formula C18H17F3N6O3S2 and a molecular weight of 486.50 g/mol. Its IUPAC name is (3S,5R)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317075 |
| Molecular Formula | C18H17F3N6O3S2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | (3S,5R)-2-methyl-5-[5-(1-methylpyrazol-4-yl)-1,3-thiazol-2-yl]-1,1-dioxo-N-(3,4,5-trifluorophenyl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2cc(F)c(F)c(F)c2)C[C@H](c2ncc(-c3cnn(C)c3)s2)NS1(=O)=O |
| InChI | InChI=1S/C18H17F3N6O3S2/c1-26-8-9(6-23-26)15-7-22-18(31-15)13-5-14(27(2)32(29,30)25-13)17(28)24-10-3-11(19)16(21)12(20)4-10/h3-4,6-8,13-14,25H,5H2,1-2H3,(H,24,28)/t13-,14+/m1/s1 |
| InChIKey | ZNQBWCZCLWMRID-KGLIPLIRSA-N |
| XLogP | 2.18 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|