C20H21ClN3O3- — CID 7028056
(1S,6R)-6-[[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7028056) has the molecular formula C20H21ClN3O3- and a molecular weight of 386.86 g/mol. Its IUPAC name is (1S,6R)-6-[[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7028056 |
| Molecular Formula | C20H21ClN3O3- |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (1S,6R)-6-[[1-[(4-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2)c(C)c1NC(=O)[C@@H]1CC=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C20H22ClN3O3/c1-12-18(22-19(25)16-5-3-4-6-17(16)20(26)27)13(2)24(23-12)11-14-7-9-15(21)10-8-14/h3-4,7-10,16-17H,5-6,11H2,1-2H3,(H,22,25)(H,26,27)/p-1/t16-,17+/m1/s1 |
| InChIKey | USIUGWOPSFXAQY-SJORKVTESA-M |
| XLogP | 2.47 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|