C20H21Cl2N3O4 — CID 56725302
6-[[1-[(2,4-dichlorophenoxy)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 56725302) has the molecular formula C20H21Cl2N3O4 and a molecular weight of 438.31 g/mol. Its IUPAC name is 6-[[1-[(2,4-dichlorophenoxy)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[1-[(2,4-dichlorophenoxy)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 56725302 |
| Molecular Formula | C20H21Cl2N3O4 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 6-[[1-[(2,4-dichlorophenoxy)methyl]-3,5-dimethylpyrazol-4-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1nn(COc2ccc(Cl)cc2Cl)c(C)c1NC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C20H21Cl2N3O4/c1-11-18(23-19(26)14-5-3-4-6-15(14)20(27)28)12(2)25(24-11)10-29-17-8-7-13(21)9-16(17)22/h3-4,7-9,14-15H,5-6,10H2,1-2H3,(H,23,26)(H,27,28) |
| InChIKey | CZDJBBRRKWUSQG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|